C16H22N2O — CID 102243444
(1S,9R,10R,16R)-16-methyl-6,14-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-11-ol (PubChem CID 102243444) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is (1S,9R,10R,16R)-16-methyl-6,14-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-11-ol.
| Compound Name | (1S,9R,10R,16R)-16-methyl-6,14-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-11-ol |
|---|---|
| PubChem CID | 102243444 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (1S,9R,10R,16R)-16-methyl-6,14-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-11-ol |
| SMILES | C[C@@H]1C[C@@H]2Cc3ncccc3[C@@]3(C1)NCCC(O)[C@H]23 |
| InChI | InChI=1S/C16H22N2O/c1-10-7-11-8-13-12(3-2-5-17-13)16(9-10)15(11)14(19)4-6-18-16/h2-3,5,10-11,14-15,18-19H,4,6-9H2,1H3/t10-,11-,14?,15+,16-/m1/s1 |
| InChIKey | UPDSILBIMXVIPG-IWSOBLICSA-N |
| XLogP | 1.85 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |