C12H15NO2 — CID 121014254
(6R)-6,7,8,9,9a,10-hexahydro-5aH-chromeno[3,2-b]pyridin-6-ol (PubChem CID 121014254) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is (6R)-6,7,8,9,9a,10-hexahydro-5aH-chromeno[3,2-b]pyridin-6-ol.
| Compound Name | (6R)-6,7,8,9,9a,10-hexahydro-5aH-chromeno[3,2-b]pyridin-6-ol |
|---|---|
| PubChem CID | 121014254 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (6R)-6,7,8,9,9a,10-hexahydro-5aH-chromeno[3,2-b]pyridin-6-ol |
| SMILES | O[C@@H]1CCCC2Cc3ncccc3OC21 |
| InChI | InChI=1S/C12H15NO2/c14-10-4-1-3-8-7-9-11(15-12(8)10)5-2-6-13-9/h2,5-6,8,10,12,14H,1,3-4,7H2/t8?,10-,12?/m1/s1 |
| InChIKey | RXIOBFLSVLNHNW-KRBLXSNTSA-N |
| XLogP | 1.55 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |