C10H13NO — CID 138752407
(5S)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-ol (PubChem CID 138752407) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (5S)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-ol.
| Compound Name | (5S)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-ol |
|---|---|
| PubChem CID | 138752407 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (5S)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-ol |
| SMILES | O[C@H]1CCCCc2ncccc21 |
| InChI | InChI=1S/C10H13NO/c12-10-6-2-1-5-9-8(10)4-3-7-11-9/h3-4,7,10,12H,1-2,5-6H2/t10-/m0/s1 |
| InChIKey | AMUSCQWNRWEJGB-JTQLQIEISA-N |
| XLogP | 1.84 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |