About N-propan-2-yl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine
N-propan-2-yl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine (PubChem CID 176861627) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is N-propan-2-yl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine.
Molecular Properties
| Compound Name | N-propan-2-yl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine |
| PubChem CID | 176861627 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N-propan-2-yl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine |
| SMILES | CC(C)NC1CCc2ncccc21 |
| InChI | InChI=1S/C11H16N2/c1-8(2)13-11-6-5-10-9(11)4-3-7-12-10/h3-4,7-8,11,13H,5-6H2,1-2H3 |
| InChIKey | LPOFVECKVWZIHY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-propan-2-yl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-yl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine?
The IUPAC name of N-propan-2-yl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine (CID 176861627) is N-propan-2-yl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine.
What is the SMILES notation for N-propan-2-yl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine?
The canonical SMILES for N-propan-2-yl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine is CC(C)NC1CCc2ncccc21.
What is the InChIKey of N-propan-2-yl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine?
The InChIKey is LPOFVECKVWZIHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-8(2)13-11-6-5-10-9(11)4-3-7-12-10/h3-4,7-8,11,13H,5-6H2,1-2H3.
What are the key properties of N-propan-2-yl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine?
N-propan-2-yl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine has a molecular weight of 176.26 g/mol, XLogP of 2.07, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-yl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine is sourced from PubChem (CID 176861627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).