C14H22N2O — CID 64734968
1-[(2-amino-3-pyridinyl)methyl]-3,5-dimethylcyclohexan-1-ol (PubChem CID 64734968) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-[(2-amino-3-pyridinyl)methyl]-3,5-dimethylcyclohexan-1-ol.
| Compound Name | 1-[(2-amino-3-pyridinyl)methyl]-3,5-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 64734968 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 1-[(2-amino-3-pyridinyl)methyl]-3,5-dimethylcyclohexan-1-ol |
| SMILES | CC1CC(C)CC(O)(Cc2cccnc2N)C1 |
| InChI | InChI=1S/C14H22N2O/c1-10-6-11(2)8-14(17,7-10)9-12-4-3-5-16-13(12)15/h3-5,10-11,17H,6-9H2,1-2H3,(H2,15,16) |
| InChIKey | OSWANKVSZIESFD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |