C12H17ClN2 — CID 64909688
3-[(3-chloro-2-methylcyclopentyl)methyl]pyridin-2-amine (PubChem CID 64909688) has the molecular formula C12H17ClN2 and a molecular weight of 224.73 g/mol. Its IUPAC name is 3-[(3-chloro-2-methylcyclopentyl)methyl]pyridin-2-amine.
| Compound Name | 3-[(3-chloro-2-methylcyclopentyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 64909688 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 3-[(3-chloro-2-methylcyclopentyl)methyl]pyridin-2-amine |
| SMILES | CC1C(Cl)CCC1Cc1cccnc1N |
| InChI | InChI=1S/C12H17ClN2/c1-8-9(4-5-11(8)13)7-10-3-2-6-15-12(10)14/h2-3,6,8-9,11H,4-5,7H2,1H3,(H2,14,15) |
| InChIKey | UAEIELFJXCKPKU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|