About methyl (E,2S)-2-[(2R)-1,2-dihydronaphthalen-2-yl]-4-phenylbut-3-enoate
methyl (E,2S)-2-[(2R)-1,2-dihydronaphthalen-2-yl]-4-phenylbut-3-enoate (PubChem CID 101348602) has the molecular formula C21H20O2
and a molecular weight of 304.39 g/mol. Its IUPAC name is methyl (E,2S)-2-[(2R)-1,2-dihydronaphthalen-2-yl]-4-phenylbut-3-enoate.
Molecular Properties
| Compound Name | methyl (E,2S)-2-[(2R)-1,2-dihydronaphthalen-2-yl]-4-phenylbut-3-enoate |
| PubChem CID | 101348602 |
| Molecular Formula | C21H20O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | methyl (E,2S)-2-[(2R)-1,2-dihydronaphthalen-2-yl]-4-phenylbut-3-enoate |
| SMILES | COC(=O)[C@@H](/C=C/c1ccccc1)[C@H]1C=Cc2ccccc2C1 |
| InChI | InChI=1S/C21H20O2/c1-23-21(22)20(14-11-16-7-3-2-4-8-16)19-13-12-17-9-5-6-10-18(17)15-19/h2-14,19-20H,15H2,1H3/b14-11+/t19-,20-/m0/s1 |
| InChIKey | DTXKYRQDWVJVSG-MKIFFDSSSA-N |
| XLogP | 4.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl (E,2S)-2-[(2R)-1,2-dihydronaphthalen-2-yl]-4-phenylbut-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E,2S)-2-[(2R)-1,2-dihydronaphthalen-2-yl]-4-phenylbut-3-enoate?
The IUPAC name of methyl (E,2S)-2-[(2R)-1,2-dihydronaphthalen-2-yl]-4-phenylbut-3-enoate (CID 101348602) is methyl (E,2S)-2-[(2R)-1,2-dihydronaphthalen-2-yl]-4-phenylbut-3-enoate.
What is the SMILES notation for methyl (E,2S)-2-[(2R)-1,2-dihydronaphthalen-2-yl]-4-phenylbut-3-enoate?
The canonical SMILES for methyl (E,2S)-2-[(2R)-1,2-dihydronaphthalen-2-yl]-4-phenylbut-3-enoate is COC(=O)[C@@H](/C=C/c1ccccc1)[C@H]1C=Cc2ccccc2C1.
What is the InChIKey of methyl (E,2S)-2-[(2R)-1,2-dihydronaphthalen-2-yl]-4-phenylbut-3-enoate?
The InChIKey is DTXKYRQDWVJVSG-MKIFFDSSSA-N. The full InChI is InChI=1S/C21H20O2/c1-23-21(22)20(14-11-16-7-3-2-4-8-16)19-13-12-17-9-5-6-10-18(17)15-19/h2-14,19-20H,15H2,1H3/b14-11+/t19-,20-/m0/s1.
What are the key properties of methyl (E,2S)-2-[(2R)-1,2-dihydronaphthalen-2-yl]-4-phenylbut-3-enoate?
methyl (E,2S)-2-[(2R)-1,2-dihydronaphthalen-2-yl]-4-phenylbut-3-enoate has a molecular weight of 304.39 g/mol, XLogP of 4.37, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E,2S)-2-[(2R)-1,2-dihydronaphthalen-2-yl]-4-phenylbut-3-enoate is sourced from PubChem (CID 101348602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).