C12H15NO2 — CID 124706120
methyl (2S)-2-amino-2-(2,3-dihydro-1H-inden-2-yl)acetate (PubChem CID 124706120) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-(2,3-dihydro-1H-inden-2-yl)acetate.
| Compound Name | methyl (2S)-2-amino-2-(2,3-dihydro-1H-inden-2-yl)acetate |
|---|---|
| PubChem CID | 124706120 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | methyl (2S)-2-amino-2-(2,3-dihydro-1H-inden-2-yl)acetate |
| SMILES | COC(=O)[C@@H](N)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C12H15NO2/c1-15-12(14)11(13)10-6-8-4-2-3-5-9(8)7-10/h2-5,10-11H,6-7,13H2,1H3/t11-/m0/s1 |
| InChIKey | YZFJYRDDABEYAI-NSHDSACASA-N |
| XLogP | 0.90 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |