C20H27NO3 — CID 58206154
prop-2-enyl (2S,5S)-5-amino-5-(2,3-dihydro-1H-inden-2-yl)-4-oxo-2-propan-2-ylpentanoate (PubChem CID 58206154) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is prop-2-enyl (2S,5S)-5-amino-5-(2,3-dihydro-1H-inden-2-yl)-4-oxo-2-propan-2-ylpentanoate.
| Compound Name | prop-2-enyl (2S,5S)-5-amino-5-(2,3-dihydro-1H-inden-2-yl)-4-oxo-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 58206154 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | prop-2-enyl (2S,5S)-5-amino-5-(2,3-dihydro-1H-inden-2-yl)-4-oxo-2-propan-2-ylpentanoate |
| SMILES | C=CCOC(=O)[C@@H](CC(=O)[C@@H](N)C1Cc2ccccc2C1)C(C)C |
| InChI | InChI=1S/C20H27NO3/c1-4-9-24-20(23)17(13(2)3)12-18(22)19(21)16-10-14-7-5-6-8-15(14)11-16/h4-8,13,16-17,19H,1,9-12,21H2,2-3H3/t17-,19-/m0/s1 |
| InChIKey | HHYYCLWNYPWVLA-HKUYNNGSSA-N |
| XLogP | 2.69 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|