C19H28N2O4 — CID 131731717
2-(2,3-dihydro-1H-inden-1-ylamino)acetic acid;prop-2-enyl (2S)-2-amino-3-methylbutanoate (PubChem CID 131731717) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-1-ylamino)acetic acid;prop-2-enyl (2S)-2-amino-3-methylbutanoate.
| Compound Name | 2-(2,3-dihydro-1H-inden-1-ylamino)acetic acid;prop-2-enyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 131731717 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-1-ylamino)acetic acid;prop-2-enyl (2S)-2-amino-3-methylbutanoate |
| SMILES | C=CCOC(=O)[C@@H](N)C(C)C.O=C(O)CNC1CCc2ccccc21 |
| InChI | InChI=1S/C11H13NO2.C8H15NO2/c13-11(14)7-12-10-6-5-8-3-1-2-4-9(8)10;1-4-5-11-8(10)7(9)6(2)3/h1-4,10,12H,5-7H2,(H,13,14);4,6-7H,1,5,9H2,2-3H3/t;7-/m.0/s1 |
| InChIKey | RMKADDYHSSLLQW-ZLTKDMPESA-N |
| XLogP | 2.05 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|