C17H23NS — CID 105181597
1-(2,3-dihydro-1-benzothiophen-3-yl)-N-propylhex-4-yn-1-amine (PubChem CID 105181597) has the molecular formula C17H23NS and a molecular weight of 273.44 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophen-3-yl)-N-propylhex-4-yn-1-amine.
| Compound Name | 1-(2,3-dihydro-1-benzothiophen-3-yl)-N-propylhex-4-yn-1-amine |
|---|---|
| PubChem CID | 105181597 |
| Molecular Formula | C17H23NS |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophen-3-yl)-N-propylhex-4-yn-1-amine |
| SMILES | CC#CCCC(NCCC)C1CSc2ccccc21 |
| InChI | InChI=1S/C17H23NS/c1-3-5-6-10-16(18-12-4-2)15-13-19-17-11-8-7-9-14(15)17/h7-9,11,15-16,18H,4,6,10,12-13H2,1-2H3 |
| InChIKey | RQOCNGSQXXJRMP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|