C14H25NO2S — CID 114190328
1-(1,1-dioxothiolan-3-yl)-N-ethyl-5,5-dimethylhex-3-yn-1-amine (PubChem CID 114190328) has the molecular formula C14H25NO2S and a molecular weight of 271.43 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-N-ethyl-5,5-dimethylhex-3-yn-1-amine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-N-ethyl-5,5-dimethylhex-3-yn-1-amine |
|---|---|
| PubChem CID | 114190328 |
| Molecular Formula | C14H25NO2S |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-N-ethyl-5,5-dimethylhex-3-yn-1-amine |
| SMILES | CCNC(CC#CC(C)(C)C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H25NO2S/c1-5-15-13(7-6-9-14(2,3)4)12-8-10-18(16,17)11-12/h12-13,15H,5,7-8,10-11H2,1-4H3 |
| InChIKey | JZZDQVRVGKXEJO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|