C11H22O3 — CID 103454796
1-(oxolan-2-yl)heptane-3,4-diol (PubChem CID 103454796) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is 1-(oxolan-2-yl)heptane-3,4-diol.
| Compound Name | 1-(oxolan-2-yl)heptane-3,4-diol |
|---|---|
| PubChem CID | 103454796 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 1-(oxolan-2-yl)heptane-3,4-diol |
| SMILES | CCCC(O)C(O)CCC1CCCO1 |
| InChI | InChI=1S/C11H22O3/c1-2-4-10(12)11(13)7-6-9-5-3-8-14-9/h9-13H,2-8H2,1H3 |
| InChIKey | GUBUZFFMPMICFV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |