C12H24O3 — CID 103454832
1-(oxolan-2-yl)octane-4,5-diol (PubChem CID 103454832) has the molecular formula C12H24O3 and a molecular weight of 216.32 g/mol. Its IUPAC name is 1-(oxolan-2-yl)octane-4,5-diol.
| Compound Name | 1-(oxolan-2-yl)octane-4,5-diol |
|---|---|
| PubChem CID | 103454832 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 1-(oxolan-2-yl)octane-4,5-diol |
| SMILES | CCCC(O)C(O)CCCC1CCCO1 |
| InChI | InChI=1S/C12H24O3/c1-2-5-11(13)12(14)8-3-6-10-7-4-9-15-10/h10-14H,2-9H2,1H3 |
| InChIKey | KAGDEDKLEOBWEE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |