C9H21N3O2S — CID 114810384
N-cyclopropyl-N'-(propan-2-ylsulfamoyl)propane-1,3-diamine (PubChem CID 114810384) has the molecular formula C9H21N3O2S and a molecular weight of 235.35 g/mol. Its IUPAC name is N-cyclopropyl-N'-(propan-2-ylsulfamoyl)propane-1,3-diamine.
| Compound Name | N-cyclopropyl-N'-(propan-2-ylsulfamoyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 114810384 |
| Molecular Formula | C9H21N3O2S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | N-cyclopropyl-N'-(propan-2-ylsulfamoyl)propane-1,3-diamine |
| SMILES | CC(C)NS(=O)(=O)NCCCNC1CC1 |
| InChI | InChI=1S/C9H21N3O2S/c1-8(2)12-15(13,14)11-7-3-6-10-9-4-5-9/h8-12H,3-7H2,1-2H3 |
| InChIKey | FFJOVJLFGFWZCF-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|