C18H24FNO3S — CID 110419539
2-cyclopropyl-N-[3-(1,1-dioxothiolan-3-yl)propyl]-2-(4-fluorophenyl)acetamide (PubChem CID 110419539) has the molecular formula C18H24FNO3S and a molecular weight of 353.46 g/mol. Its IUPAC name is 2-cyclopropyl-N-[3-(1,1-dioxothiolan-3-yl)propyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | 2-cyclopropyl-N-[3-(1,1-dioxothiolan-3-yl)propyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 110419539 |
| Molecular Formula | C18H24FNO3S |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 2-cyclopropyl-N-[3-(1,1-dioxothiolan-3-yl)propyl]-2-(4-fluorophenyl)acetamide |
| SMILES | O=C(NCCCC1CCS(=O)(=O)C1)C(c1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C18H24FNO3S/c19-16-7-5-15(6-8-16)17(14-3-4-14)18(21)20-10-1-2-13-9-11-24(22,23)12-13/h5-8,13-14,17H,1-4,9-12H2,(H,20,21) |
| InChIKey | SKVCXCANLGXLMR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|