C13H23N3O4S — CID 95159121
1-(1-acetylpiperidin-4-yl)-3-[[(3R)-1,1-dioxothiolan-3-yl]methyl]urea (PubChem CID 95159121) has the molecular formula C13H23N3O4S and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-(1-acetylpiperidin-4-yl)-3-[[(3R)-1,1-dioxothiolan-3-yl]methyl]urea.
| Compound Name | 1-(1-acetylpiperidin-4-yl)-3-[[(3R)-1,1-dioxothiolan-3-yl]methyl]urea |
|---|---|
| PubChem CID | 95159121 |
| Molecular Formula | C13H23N3O4S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 1-(1-acetylpiperidin-4-yl)-3-[[(3R)-1,1-dioxothiolan-3-yl]methyl]urea |
| SMILES | CC(=O)N1CCC(NC(=O)NC[C@H]2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C13H23N3O4S/c1-10(17)16-5-2-12(3-6-16)15-13(18)14-8-11-4-7-21(19,20)9-11/h11-12H,2-9H2,1H3,(H2,14,15,18)/t11-/m1/s1 |
| InChIKey | OEDNDMAONUZPPR-LLVKDONJSA-N |
| XLogP | -0.27 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |