C14H25N3O3 — CID 25072677
1-(1-acetylpiperidin-4-yl)-3-(oxan-4-ylmethyl)urea (PubChem CID 25072677) has the molecular formula C14H25N3O3 and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-(1-acetylpiperidin-4-yl)-3-(oxan-4-ylmethyl)urea.
| Compound Name | 1-(1-acetylpiperidin-4-yl)-3-(oxan-4-ylmethyl)urea |
|---|---|
| PubChem CID | 25072677 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 1-(1-acetylpiperidin-4-yl)-3-(oxan-4-ylmethyl)urea |
| SMILES | CC(=O)N1CCC(NC(=O)NCC2CCOCC2)CC1 |
| InChI | InChI=1S/C14H25N3O3/c1-11(18)17-6-2-13(3-7-17)16-14(19)15-10-12-4-8-20-9-5-12/h12-13H,2-10H2,1H3,(H2,15,16,19) |
| InChIKey | DRWZFIRUSSUAKR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |