C16H29N3O3 — CID 164639080
1-[[(3R)-1-acetylpiperidin-3-yl]methyl]-3-[4-(hydroxymethyl)cyclohexyl]urea (PubChem CID 164639080) has the molecular formula C16H29N3O3 and a molecular weight of 311.43 g/mol. Its IUPAC name is 1-[[(3R)-1-acetylpiperidin-3-yl]methyl]-3-[4-(hydroxymethyl)cyclohexyl]urea.
| Compound Name | 1-[[(3R)-1-acetylpiperidin-3-yl]methyl]-3-[4-(hydroxymethyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 164639080 |
| Molecular Formula | C16H29N3O3 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 1-[[(3R)-1-acetylpiperidin-3-yl]methyl]-3-[4-(hydroxymethyl)cyclohexyl]urea |
| SMILES | CC(=O)N1CCC[C@H](CNC(=O)NC2CCC(CO)CC2)C1 |
| InChI | InChI=1S/C16H29N3O3/c1-12(21)19-8-2-3-14(10-19)9-17-16(22)18-15-6-4-13(11-20)5-7-15/h13-15,20H,2-11H2,1H3,(H2,17,18,22)/t13?,14-,15?/m1/s1 |
| InChIKey | RCGJRSBYPSFTAZ-SHARSMKWSA-N |
| XLogP | 1.10 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |