C11H22N4O — CID 117234763
1-(azetidin-3-ylmethyl)-3-(1-methylpiperidin-3-yl)urea (PubChem CID 117234763) has the molecular formula C11H22N4O and a molecular weight of 226.32 g/mol. Its IUPAC name is 1-(azetidin-3-ylmethyl)-3-(1-methylpiperidin-3-yl)urea.
| Compound Name | 1-(azetidin-3-ylmethyl)-3-(1-methylpiperidin-3-yl)urea |
|---|---|
| PubChem CID | 117234763 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 1-(azetidin-3-ylmethyl)-3-(1-methylpiperidin-3-yl)urea |
| SMILES | CN1CCCC(NC(=O)NCC2CNC2)C1 |
| InChI | InChI=1S/C11H22N4O/c1-15-4-2-3-10(8-15)14-11(16)13-7-9-5-12-6-9/h9-10,12H,2-8H2,1H3,(H2,13,14,16) |
| InChIKey | PQROLQCIFOMPCE-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |