C12H24N4O — CID 117234729
1-(1-methylpiperidin-3-yl)-3-piperidin-4-ylurea (PubChem CID 117234729) has the molecular formula C12H24N4O and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-(1-methylpiperidin-3-yl)-3-piperidin-4-ylurea.
| Compound Name | 1-(1-methylpiperidin-3-yl)-3-piperidin-4-ylurea |
|---|---|
| PubChem CID | 117234729 |
| Molecular Formula | C12H24N4O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | 1-(1-methylpiperidin-3-yl)-3-piperidin-4-ylurea |
| SMILES | CN1CCCC(NC(=O)NC2CCNCC2)C1 |
| InChI | InChI=1S/C12H24N4O/c1-16-8-2-3-11(9-16)15-12(17)14-10-4-6-13-7-5-10/h10-11,13H,2-9H2,1H3,(H2,14,15,17) |
| InChIKey | LUYIDGIWOHYDSN-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |