C13H17ClO2S — CID 80621737
2-(5-chloro-2-methoxyphenyl)-1-(thiolan-2-yl)ethanol (PubChem CID 80621737) has the molecular formula C13H17ClO2S and a molecular weight of 272.80 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)-1-(thiolan-2-yl)ethanol.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)-1-(thiolan-2-yl)ethanol |
|---|---|
| PubChem CID | 80621737 |
| Molecular Formula | C13H17ClO2S |
| Molecular Weight | 272.80 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)-1-(thiolan-2-yl)ethanol |
| SMILES | COc1ccc(Cl)cc1CC(O)C1CCCS1 |
| InChI | InChI=1S/C13H17ClO2S/c1-16-12-5-4-10(14)7-9(12)8-11(15)13-3-2-6-17-13/h4-5,7,11,13,15H,2-3,6,8H2,1H3 |
| InChIKey | ZJMBOLYVQFHPFG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.80 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |