C16H23ClOS — CID 66153922
2-(2-chlorophenyl)sulfanyl-1-(3-ethylcyclohexyl)ethanol (PubChem CID 66153922) has the molecular formula C16H23ClOS and a molecular weight of 298.88 g/mol. Its IUPAC name is 2-(2-chlorophenyl)sulfanyl-1-(3-ethylcyclohexyl)ethanol.
| Compound Name | 2-(2-chlorophenyl)sulfanyl-1-(3-ethylcyclohexyl)ethanol |
|---|---|
| PubChem CID | 66153922 |
| Molecular Formula | C16H23ClOS |
| Molecular Weight | 298.88 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-(2-chlorophenyl)sulfanyl-1-(3-ethylcyclohexyl)ethanol |
| SMILES | CCC1CCCC(C(O)CSc2ccccc2Cl)C1 |
| InChI | InChI=1S/C16H23ClOS/c1-2-12-6-5-7-13(10-12)15(18)11-19-16-9-4-3-8-14(16)17/h3-4,8-9,12-13,15,18H,2,5-7,10-11H2,1H3 |
| InChIKey | GNZVHXXCNMAEPS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.88 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |