C14H19ClO — CID 65411144
(2-chlorophenyl)-(3-ethylcyclopentyl)methanol (PubChem CID 65411144) has the molecular formula C14H19ClO and a molecular weight of 238.76 g/mol. Its IUPAC name is (2-chlorophenyl)-(3-ethylcyclopentyl)methanol.
| Compound Name | (2-chlorophenyl)-(3-ethylcyclopentyl)methanol |
|---|---|
| PubChem CID | 65411144 |
| Molecular Formula | C14H19ClO |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (2-chlorophenyl)-(3-ethylcyclopentyl)methanol |
| SMILES | CCC1CCC(C(O)c2ccccc2Cl)C1 |
| InChI | InChI=1S/C14H19ClO/c1-2-10-7-8-11(9-10)14(16)12-5-3-4-6-13(12)15/h3-6,10-11,14,16H,2,7-9H2,1H3 |
| InChIKey | YAEDJHQQYBXMPA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |