C16H23BrO — CID 107985730
(2-bromo-3-methylphenyl)-(3-ethylcyclohexyl)methanol (PubChem CID 107985730) has the molecular formula C16H23BrO and a molecular weight of 311.26 g/mol. Its IUPAC name is (2-bromo-3-methylphenyl)-(3-ethylcyclohexyl)methanol.
| Compound Name | (2-bromo-3-methylphenyl)-(3-ethylcyclohexyl)methanol |
|---|---|
| PubChem CID | 107985730 |
| Molecular Formula | C16H23BrO |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | (2-bromo-3-methylphenyl)-(3-ethylcyclohexyl)methanol |
| SMILES | CCC1CCCC(C(O)c2cccc(C)c2Br)C1 |
| InChI | InChI=1S/C16H23BrO/c1-3-12-7-5-8-13(10-12)16(18)14-9-4-6-11(2)15(14)17/h4,6,9,12-13,16,18H,3,5,7-8,10H2,1-2H3 |
| InChIKey | BDPKIQRTNVFSDT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |