C10H18F3NO — CID 116592893
2-amino-1,1,1-trifluoro-2,6,6-trimethylheptan-3-one (PubChem CID 116592893) has the molecular formula C10H18F3NO and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-amino-1,1,1-trifluoro-2,6,6-trimethylheptan-3-one.
| Compound Name | 2-amino-1,1,1-trifluoro-2,6,6-trimethylheptan-3-one |
|---|---|
| PubChem CID | 116592893 |
| Molecular Formula | C10H18F3NO |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 2-amino-1,1,1-trifluoro-2,6,6-trimethylheptan-3-one |
| SMILES | CC(C)(C)CCC(=O)C(C)(N)C(F)(F)F |
| InChI | InChI=1S/C10H18F3NO/c1-8(2,3)6-5-7(15)9(4,14)10(11,12)13/h5-6,14H2,1-4H3 |
| InChIKey | CQPCGIMDUARFCA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |