C13H27NO — CID 116603712
3-(aminomethyl)-3-ethyl-7,7-dimethyloctan-4-one (PubChem CID 116603712) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is 3-(aminomethyl)-3-ethyl-7,7-dimethyloctan-4-one.
| Compound Name | 3-(aminomethyl)-3-ethyl-7,7-dimethyloctan-4-one |
|---|---|
| PubChem CID | 116603712 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 3-(aminomethyl)-3-ethyl-7,7-dimethyloctan-4-one |
| SMILES | CCC(CC)(CN)C(=O)CCC(C)(C)C |
| InChI | InChI=1S/C13H27NO/c1-6-13(7-2,10-14)11(15)8-9-12(3,4)5/h6-10,14H2,1-5H3 |
| InChIKey | GQYSQWYHTGCGEP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |