C9H16F3NO — CID 116611006
5-(aminomethyl)-1,1,1-trifluoro-5-methylheptan-4-one (PubChem CID 116611006) has the molecular formula C9H16F3NO and a molecular weight of 211.23 g/mol. Its IUPAC name is 5-(aminomethyl)-1,1,1-trifluoro-5-methylheptan-4-one.
| Compound Name | 5-(aminomethyl)-1,1,1-trifluoro-5-methylheptan-4-one |
|---|---|
| PubChem CID | 116611006 |
| Molecular Formula | C9H16F3NO |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 5-(aminomethyl)-1,1,1-trifluoro-5-methylheptan-4-one |
| SMILES | CCC(C)(CN)C(=O)CCC(F)(F)F |
| InChI | InChI=1S/C9H16F3NO/c1-3-8(2,6-13)7(14)4-5-9(10,11)12/h3-6,13H2,1-2H3 |
| InChIKey | OIYOTANVZPAQDB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |