C9H15F3O2 — CID 103447033
5-ethyl-1,1,1-trifluoro-5-hydroxyheptan-4-one (PubChem CID 103447033) has the molecular formula C9H15F3O2 and a molecular weight of 212.21 g/mol. Its IUPAC name is 5-ethyl-1,1,1-trifluoro-5-hydroxyheptan-4-one.
| Compound Name | 5-ethyl-1,1,1-trifluoro-5-hydroxyheptan-4-one |
|---|---|
| PubChem CID | 103447033 |
| Molecular Formula | C9H15F3O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 5-ethyl-1,1,1-trifluoro-5-hydroxyheptan-4-one |
| SMILES | CCC(O)(CC)C(=O)CCC(F)(F)F |
| InChI | InChI=1S/C9H15F3O2/c1-3-8(14,4-2)7(13)5-6-9(10,11)12/h14H,3-6H2,1-2H3 |
| InChIKey | BMCRUZAUAVATBH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |