C11H17F3O4 — CID 168861748
methyl (2S)-6,6,6-trifluoro-2-hydroxy-2-(2-methylpropyl)-3-oxohexanoate (PubChem CID 168861748) has the molecular formula C11H17F3O4 and a molecular weight of 270.25 g/mol. Its IUPAC name is methyl (2S)-6,6,6-trifluoro-2-hydroxy-2-(2-methylpropyl)-3-oxohexanoate.
| Compound Name | methyl (2S)-6,6,6-trifluoro-2-hydroxy-2-(2-methylpropyl)-3-oxohexanoate |
|---|---|
| PubChem CID | 168861748 |
| Molecular Formula | C11H17F3O4 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | methyl (2S)-6,6,6-trifluoro-2-hydroxy-2-(2-methylpropyl)-3-oxohexanoate |
| SMILES | COC(=O)[C@](O)(CC(C)C)C(=O)CCC(F)(F)F |
| InChI | InChI=1S/C11H17F3O4/c1-7(2)6-10(17,9(16)18-3)8(15)4-5-11(12,13)14/h7,17H,4-6H2,1-3H3/t10-/m0/s1 |
| InChIKey | PQBXVVJIDONCBL-JTQLQIEISA-N |
| XLogP | 1.85 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|