C12H23F3O — CID 114865192
1,1,1-trifluoro-6-methyl-4-(2-methylpropyl)heptan-4-ol (PubChem CID 114865192) has the molecular formula C12H23F3O and a molecular weight of 240.31 g/mol. Its IUPAC name is 1,1,1-trifluoro-6-methyl-4-(2-methylpropyl)heptan-4-ol.
| Compound Name | 1,1,1-trifluoro-6-methyl-4-(2-methylpropyl)heptan-4-ol |
|---|---|
| PubChem CID | 114865192 |
| Molecular Formula | C12H23F3O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 1,1,1-trifluoro-6-methyl-4-(2-methylpropyl)heptan-4-ol |
| SMILES | CC(C)CC(O)(CCC(F)(F)F)CC(C)C |
| InChI | InChI=1S/C12H23F3O/c1-9(2)7-11(16,8-10(3)4)5-6-12(13,14)15/h9-10,16H,5-8H2,1-4H3 |
| InChIKey | ITVJGONSFPONFA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |