C7H9F6NO — CID 116593115
2-amino-1,1,1,6,6,6-hexafluoro-2-methylhexan-3-one (PubChem CID 116593115) has the molecular formula C7H9F6NO and a molecular weight of 237.14 g/mol. Its IUPAC name is 2-amino-1,1,1,6,6,6-hexafluoro-2-methylhexan-3-one.
| Compound Name | 2-amino-1,1,1,6,6,6-hexafluoro-2-methylhexan-3-one |
|---|---|
| PubChem CID | 116593115 |
| Molecular Formula | C7H9F6NO |
| Molecular Weight | 237.14 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 2-amino-1,1,1,6,6,6-hexafluoro-2-methylhexan-3-one |
| SMILES | CC(N)(C(=O)CCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H9F6NO/c1-5(14,7(11,12)13)4(15)2-3-6(8,9)10/h2-3,14H2,1H3 |
| InChIKey | NWDKOVSFLXQFPL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.14 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |