C8H14F3NO2 — CID 116593052
3-amino-4,4,4-trifluoro-3-methyl-1-propoxybutan-2-one (PubChem CID 116593052) has the molecular formula C8H14F3NO2 and a molecular weight of 213.20 g/mol. Its IUPAC name is 3-amino-4,4,4-trifluoro-3-methyl-1-propoxybutan-2-one.
| Compound Name | 3-amino-4,4,4-trifluoro-3-methyl-1-propoxybutan-2-one |
|---|---|
| PubChem CID | 116593052 |
| Molecular Formula | C8H14F3NO2 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 3-amino-4,4,4-trifluoro-3-methyl-1-propoxybutan-2-one |
| SMILES | CCCOCC(=O)C(C)(N)C(F)(F)F |
| InChI | InChI=1S/C8H14F3NO2/c1-3-4-14-5-6(13)7(2,12)8(9,10)11/h3-5,12H2,1-2H3 |
| InChIKey | JHXFIZHMPWDXAN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|