C8H12F6O — CID 20802182
1,1,1,3,3,3-hexafluoro-2-methyl-2-(propoxymethyl)propane (PubChem CID 20802182) has the molecular formula C8H12F6O and a molecular weight of 238.17 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-methyl-2-(propoxymethyl)propane.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-methyl-2-(propoxymethyl)propane |
|---|---|
| PubChem CID | 20802182 |
| Molecular Formula | C8H12F6O |
| Molecular Weight | 238.17 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-methyl-2-(propoxymethyl)propane |
| SMILES | CCCOCC(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H12F6O/c1-3-4-15-5-6(2,7(9,10)11)8(12,13)14/h3-5H2,1-2H3 |
| InChIKey | GFDHJXCBQFMLGX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.17 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|