C11H21F3O — CID 142957389
1,1,1-trifluoro-2,2,3,3-tetramethyl-4-propoxybutane (PubChem CID 142957389) has the molecular formula C11H21F3O and a molecular weight of 226.28 g/mol. Its IUPAC name is 1,1,1-trifluoro-2,2,3,3-tetramethyl-4-propoxybutane.
| Compound Name | 1,1,1-trifluoro-2,2,3,3-tetramethyl-4-propoxybutane |
|---|---|
| PubChem CID | 142957389 |
| Molecular Formula | C11H21F3O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 1,1,1-trifluoro-2,2,3,3-tetramethyl-4-propoxybutane |
| SMILES | CCCOCC(C)(C)C(C)(C)C(F)(F)F |
| InChI | InChI=1S/C11H21F3O/c1-6-7-15-8-9(2,3)10(4,5)11(12,13)14/h6-8H2,1-5H3 |
| InChIKey | NWHPRWXEOMCSRG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|