C14H26Cl2O2Te — CID 15143199
1-[dichloro-(4,4-dimethyl-3-oxopentyl)-lambda4-tellanyl]-4,4-dimethylpentan-3-one (PubChem CID 15143199) has the molecular formula C14H26Cl2O2Te and a molecular weight of 424.87 g/mol. Its IUPAC name is 1-[dichloro-(4,4-dimethyl-3-oxopentyl)-lambda4-tellanyl]-4,4-dimethylpentan-3-one.
| Compound Name | 1-[dichloro-(4,4-dimethyl-3-oxopentyl)-lambda4-tellanyl]-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 15143199 |
| Molecular Formula | C14H26Cl2O2Te |
| Molecular Weight | 424.87 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 1-[dichloro-(4,4-dimethyl-3-oxopentyl)-lambda4-tellanyl]-4,4-dimethylpentan-3-one |
| SMILES | CC(C)(C)C(=O)CC[Te](Cl)(Cl)CCC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H26Cl2O2Te/c1-13(2,3)11(17)7-9-19(15,16)10-8-12(18)14(4,5)6/h7-10H2,1-6H3 |
| InChIKey | YGJCCURQNJHKIG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.87 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|