C17H33NO3S — CID 157264634
N-[2-[2-(5,5-dimethyl-4-oxohexoxy)ethoxy]ethyl]-2,2-dimethylpropanethioamide (PubChem CID 157264634) has the molecular formula C17H33NO3S and a molecular weight of 331.52 g/mol. Its IUPAC name is N-[2-[2-(5,5-dimethyl-4-oxohexoxy)ethoxy]ethyl]-2,2-dimethylpropanethioamide.
| Compound Name | N-[2-[2-(5,5-dimethyl-4-oxohexoxy)ethoxy]ethyl]-2,2-dimethylpropanethioamide |
|---|---|
| PubChem CID | 157264634 |
| Molecular Formula | C17H33NO3S |
| Molecular Weight | 331.52 g/mol |
| Exact Mass | 331.22 |
| IUPAC Name | N-[2-[2-(5,5-dimethyl-4-oxohexoxy)ethoxy]ethyl]-2,2-dimethylpropanethioamide |
| SMILES | CC(C)(C)C(=O)CCCOCCOCCNC(=S)C(C)(C)C |
| InChI | InChI=1S/C17H33NO3S/c1-16(2,3)14(19)8-7-10-20-12-13-21-11-9-18-15(22)17(4,5)6/h7-13H2,1-6H3,(H,18,22) |
| InChIKey | FMXXKRHHIJZVPU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|