About (6S)-2,6-dimethyldecan-3-one
(6S)-2,6-dimethyldecan-3-one (PubChem CID 71584493) has the molecular formula C12H24O
and a molecular weight of 184.32 g/mol. Its IUPAC name is (6S)-2,6-dimethyldecan-3-one.
Molecular Properties
| Compound Name | (6S)-2,6-dimethyldecan-3-one |
| PubChem CID | 71584493 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | (6S)-2,6-dimethyldecan-3-one |
| SMILES | CCCC[C@H](C)CCC(=O)C(C)C |
| InChI | InChI=1S/C12H24O/c1-5-6-7-11(4)8-9-12(13)10(2)3/h10-11H,5-9H2,1-4H3/t11-/m0/s1 |
| InChIKey | IRLKDGUIOLWNCX-NSHDSACASA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (6S)-2,6-dimethyldecan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-2,6-dimethyldecan-3-one?
The IUPAC name of (6S)-2,6-dimethyldecan-3-one (CID 71584493) is (6S)-2,6-dimethyldecan-3-one.
What is the SMILES notation for (6S)-2,6-dimethyldecan-3-one?
The canonical SMILES for (6S)-2,6-dimethyldecan-3-one is CCCC[C@H](C)CCC(=O)C(C)C.
What is the InChIKey of (6S)-2,6-dimethyldecan-3-one?
The InChIKey is IRLKDGUIOLWNCX-NSHDSACASA-N. The full InChI is InChI=1S/C12H24O/c1-5-6-7-11(4)8-9-12(13)10(2)3/h10-11H,5-9H2,1-4H3/t11-/m0/s1.
What are the key properties of (6S)-2,6-dimethyldecan-3-one?
(6S)-2,6-dimethyldecan-3-one has a molecular weight of 184.32 g/mol, XLogP of 3.82, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-2,6-dimethyldecan-3-one is sourced from PubChem (CID 71584493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).