About 3-methylheptan-1-amine;propan-2-one
3-methylheptan-1-amine;propan-2-one (PubChem CID 145353822) has the molecular formula C11H25NO
and a molecular weight of 187.33 g/mol. Its IUPAC name is 3-methylheptan-1-amine;propan-2-one.
Molecular Properties
| Compound Name | 3-methylheptan-1-amine;propan-2-one |
| PubChem CID | 145353822 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | 3-methylheptan-1-amine;propan-2-one |
| SMILES | CC(C)=O.CCCCC(C)CCN |
| InChI | InChI=1S/C8H19N.C3H6O/c1-3-4-5-8(2)6-7-9;1-3(2)4/h8H,3-7,9H2,1-2H3;1-2H3 |
| InChIKey | GOTZRIHPUKEEON-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylheptan-1-amine;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylheptan-1-amine;propan-2-one?
The IUPAC name of 3-methylheptan-1-amine;propan-2-one (CID 145353822) is 3-methylheptan-1-amine;propan-2-one.
What is the SMILES notation for 3-methylheptan-1-amine;propan-2-one?
The canonical SMILES for 3-methylheptan-1-amine;propan-2-one is CC(C)=O.CCCCC(C)CCN.
What is the InChIKey of 3-methylheptan-1-amine;propan-2-one?
The InChIKey is GOTZRIHPUKEEON-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.C3H6O/c1-3-4-5-8(2)6-7-9;1-3(2)4/h8H,3-7,9H2,1-2H3;1-2H3.
What are the key properties of 3-methylheptan-1-amine;propan-2-one?
3-methylheptan-1-amine;propan-2-one has a molecular weight of 187.33 g/mol, XLogP of 2.76, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylheptan-1-amine;propan-2-one is sourced from PubChem (CID 145353822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).