About 5-(dimethylamino)-2-methyl-5-oxopentanoic acid;methyl 5-(dimethylamino)-2-methyl-5-oxopentanoate
5-(dimethylamino)-2-methyl-5-oxopentanoic acid;methyl 5-(dimethylamino)-2-methyl-5-oxopentanoate (PubChem CID 175356213) has the molecular formula C17H32N2O6
and a molecular weight of 360.45 g/mol. Its IUPAC name is 5-(dimethylamino)-2-methyl-5-oxopentanoic acid;methyl 5-(dimethylamino)-2-methyl-5-oxopentanoate.
Molecular Properties
| Compound Name | 5-(dimethylamino)-2-methyl-5-oxopentanoic acid;methyl 5-(dimethylamino)-2-methyl-5-oxopentanoate |
| PubChem CID | 175356213 |
| Molecular Formula | C17H32N2O6 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 5-(dimethylamino)-2-methyl-5-oxopentanoic acid;methyl 5-(dimethylamino)-2-methyl-5-oxopentanoate |
| SMILES | CC(CCC(=O)N(C)C)C(=O)O.COC(=O)C(C)CCC(=O)N(C)C |
| InChI | InChI=1S/C9H17NO3.C8H15NO3/c1-7(9(12)13-4)5-6-8(11)10(2)3;1-6(8(11)12)4-5-7(10)9(2)3/h7H,5-6H2,1-4H3;6H,4-5H2,1-3H3,(H,11,12) |
| InChIKey | NVJOUTICTKEHQT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(dimethylamino)-2-methyl-5-oxopentanoic acid;methyl 5-(dimethylamino)-2-methyl-5-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dimethylamino)-2-methyl-5-oxopentanoic acid;methyl 5-(dimethylamino)-2-methyl-5-oxopentanoate?
The IUPAC name of 5-(dimethylamino)-2-methyl-5-oxopentanoic acid;methyl 5-(dimethylamino)-2-methyl-5-oxopentanoate (CID 175356213) is 5-(dimethylamino)-2-methyl-5-oxopentanoic acid;methyl 5-(dimethylamino)-2-methyl-5-oxopentanoate.
What is the SMILES notation for 5-(dimethylamino)-2-methyl-5-oxopentanoic acid;methyl 5-(dimethylamino)-2-methyl-5-oxopentanoate?
The canonical SMILES for 5-(dimethylamino)-2-methyl-5-oxopentanoic acid;methyl 5-(dimethylamino)-2-methyl-5-oxopentanoate is CC(CCC(=O)N(C)C)C(=O)O.COC(=O)C(C)CCC(=O)N(C)C.
What is the InChIKey of 5-(dimethylamino)-2-methyl-5-oxopentanoic acid;methyl 5-(dimethylamino)-2-methyl-5-oxopentanoate?
The InChIKey is NVJOUTICTKEHQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3.C8H15NO3/c1-7(9(12)13-4)5-6-8(11)10(2)3;1-6(8(11)12)4-5-7(10)9(2)3/h7H,5-6H2,1-4H3;6H,4-5H2,1-3H3,(H,11,12).
What are the key properties of 5-(dimethylamino)-2-methyl-5-oxopentanoic acid;methyl 5-(dimethylamino)-2-methyl-5-oxopentanoate?
5-(dimethylamino)-2-methyl-5-oxopentanoic acid;methyl 5-(dimethylamino)-2-methyl-5-oxopentanoate has a molecular weight of 360.45 g/mol, XLogP of 1.24, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dimethylamino)-2-methyl-5-oxopentanoic acid;methyl 5-(dimethylamino)-2-methyl-5-oxopentanoate is sourced from PubChem (CID 175356213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).