About 4-(aminomethyl)-N,N-dimethylheptanamide
4-(aminomethyl)-N,N-dimethylheptanamide (PubChem CID 112515140) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is 4-(aminomethyl)-N,N-dimethylheptanamide.
Molecular Properties
| Compound Name | 4-(aminomethyl)-N,N-dimethylheptanamide |
| PubChem CID | 112515140 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 4-(aminomethyl)-N,N-dimethylheptanamide |
| SMILES | CCCC(CN)CCC(=O)N(C)C |
| InChI | InChI=1S/C10H22N2O/c1-4-5-9(8-11)6-7-10(13)12(2)3/h9H,4-8,11H2,1-3H3 |
| InChIKey | VLWXKPFSLQDCNM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(aminomethyl)-N,N-dimethylheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-N,N-dimethylheptanamide?
The IUPAC name of 4-(aminomethyl)-N,N-dimethylheptanamide (CID 112515140) is 4-(aminomethyl)-N,N-dimethylheptanamide.
What is the SMILES notation for 4-(aminomethyl)-N,N-dimethylheptanamide?
The canonical SMILES for 4-(aminomethyl)-N,N-dimethylheptanamide is CCCC(CN)CCC(=O)N(C)C.
What is the InChIKey of 4-(aminomethyl)-N,N-dimethylheptanamide?
The InChIKey is VLWXKPFSLQDCNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O/c1-4-5-9(8-11)6-7-10(13)12(2)3/h9H,4-8,11H2,1-3H3.
What are the key properties of 4-(aminomethyl)-N,N-dimethylheptanamide?
4-(aminomethyl)-N,N-dimethylheptanamide has a molecular weight of 186.30 g/mol, XLogP of 1.23, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-N,N-dimethylheptanamide is sourced from PubChem (CID 112515140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).