C10H22N2O — CID 112515140
4-(aminomethyl)-N,N-dimethylheptanamide (PubChem CID 112515140) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is 4-(aminomethyl)-N,N-dimethylheptanamide.
| Compound Name | 4-(aminomethyl)-N,N-dimethylheptanamide |
|---|---|
| PubChem CID | 112515140 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 4-(aminomethyl)-N,N-dimethylheptanamide |
| SMILES | CCCC(CN)CCC(=O)N(C)C |
| InChI | InChI=1S/C10H22N2O/c1-4-5-9(8-11)6-7-10(13)12(2)3/h9H,4-8,11H2,1-3H3 |
| InChIKey | VLWXKPFSLQDCNM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |