C8H19N3O — CID 79154615
3-(1-aminopentan-2-yl)-1,1-dimethylurea (PubChem CID 79154615) has the molecular formula C8H19N3O and a molecular weight of 173.26 g/mol. Its IUPAC name is 3-(1-aminopentan-2-yl)-1,1-dimethylurea.
| Compound Name | 3-(1-aminopentan-2-yl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 79154615 |
| Molecular Formula | C8H19N3O |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.15 |
| IUPAC Name | 3-(1-aminopentan-2-yl)-1,1-dimethylurea |
| SMILES | CCCC(CN)NC(=O)N(C)C |
| InChI | InChI=1S/C8H19N3O/c1-4-5-7(6-9)10-8(12)11(2)3/h7H,4-6,9H2,1-3H3,(H,10,12) |
| InChIKey | COANBBFETITWGH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |