About N-(1-aminopropan-2-yl)-N,2-dimethylpentane-1-sulfonamide;hydrochloride
N-(1-aminopropan-2-yl)-N,2-dimethylpentane-1-sulfonamide;hydrochloride (PubChem CID 119982739) has the molecular formula C10H25ClN2O2S
and a molecular weight of 272.84 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-N,2-dimethylpentane-1-sulfonamide;hydrochloride.
Molecular Properties
| Compound Name | N-(1-aminopropan-2-yl)-N,2-dimethylpentane-1-sulfonamide;hydrochloride |
| PubChem CID | 119982739 |
| Molecular Formula | C10H25ClN2O2S |
| Molecular Weight | 272.84 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-(1-aminopropan-2-yl)-N,2-dimethylpentane-1-sulfonamide;hydrochloride |
| SMILES | CCCC(C)CS(=O)(=O)N(C)C(C)CN.Cl |
| InChI | InChI=1S/C10H24N2O2S.ClH/c1-5-6-9(2)8-15(13,14)12(4)10(3)7-11;/h9-10H,5-8,11H2,1-4H3;1H |
| InChIKey | MYZOEBRQGMZDIF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.84 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-aminopropan-2-yl)-N,2-dimethylpentane-1-sulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-aminopropan-2-yl)-N,2-dimethylpentane-1-sulfonamide;hydrochloride?
The IUPAC name of N-(1-aminopropan-2-yl)-N,2-dimethylpentane-1-sulfonamide;hydrochloride (CID 119982739) is N-(1-aminopropan-2-yl)-N,2-dimethylpentane-1-sulfonamide;hydrochloride.
What is the SMILES notation for N-(1-aminopropan-2-yl)-N,2-dimethylpentane-1-sulfonamide;hydrochloride?
The canonical SMILES for N-(1-aminopropan-2-yl)-N,2-dimethylpentane-1-sulfonamide;hydrochloride is CCCC(C)CS(=O)(=O)N(C)C(C)CN.Cl.
What is the InChIKey of N-(1-aminopropan-2-yl)-N,2-dimethylpentane-1-sulfonamide;hydrochloride?
The InChIKey is MYZOEBRQGMZDIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2O2S.ClH/c1-5-6-9(2)8-15(13,14)12(4)10(3)7-11;/h9-10H,5-8,11H2,1-4H3;1H.
What are the key properties of N-(1-aminopropan-2-yl)-N,2-dimethylpentane-1-sulfonamide;hydrochloride?
N-(1-aminopropan-2-yl)-N,2-dimethylpentane-1-sulfonamide;hydrochloride has a molecular weight of 272.84 g/mol, XLogP of 1.45, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-aminopropan-2-yl)-N,2-dimethylpentane-1-sulfonamide;hydrochloride is sourced from PubChem (CID 119982739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).