About N-(1-amino-2,4-dimethylpentan-2-yl)-2-methylpentane-1-sulfonamide;hydrochloride
N-(1-amino-2,4-dimethylpentan-2-yl)-2-methylpentane-1-sulfonamide;hydrochloride (PubChem CID 119985236) has the molecular formula C13H31ClN2O2S
and a molecular weight of 314.92 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-2-methylpentane-1-sulfonamide;hydrochloride.
Molecular Properties
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-2-methylpentane-1-sulfonamide;hydrochloride |
| PubChem CID | 119985236 |
| Molecular Formula | C13H31ClN2O2S |
| Molecular Weight | 314.92 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-2-methylpentane-1-sulfonamide;hydrochloride |
| SMILES | CCCC(C)CS(=O)(=O)NC(C)(CN)CC(C)C.Cl |
| InChI | InChI=1S/C13H30N2O2S.ClH/c1-6-7-12(4)9-18(16,17)15-13(5,10-14)8-11(2)3;/h11-12,15H,6-10,14H2,1-5H3;1H |
| InChIKey | QBWGRYDTVUSCQI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.92 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-amino-2,4-dimethylpentan-2-yl)-2-methylpentane-1-sulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-amino-2,4-dimethylpentan-2-yl)-2-methylpentane-1-sulfonamide;hydrochloride?
The IUPAC name of N-(1-amino-2,4-dimethylpentan-2-yl)-2-methylpentane-1-sulfonamide;hydrochloride (CID 119985236) is N-(1-amino-2,4-dimethylpentan-2-yl)-2-methylpentane-1-sulfonamide;hydrochloride.
What is the SMILES notation for N-(1-amino-2,4-dimethylpentan-2-yl)-2-methylpentane-1-sulfonamide;hydrochloride?
The canonical SMILES for N-(1-amino-2,4-dimethylpentan-2-yl)-2-methylpentane-1-sulfonamide;hydrochloride is CCCC(C)CS(=O)(=O)NC(C)(CN)CC(C)C.Cl.
What is the InChIKey of N-(1-amino-2,4-dimethylpentan-2-yl)-2-methylpentane-1-sulfonamide;hydrochloride?
The InChIKey is QBWGRYDTVUSCQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30N2O2S.ClH/c1-6-7-12(4)9-18(16,17)15-13(5,10-14)8-11(2)3;/h11-12,15H,6-10,14H2,1-5H3;1H.
What are the key properties of N-(1-amino-2,4-dimethylpentan-2-yl)-2-methylpentane-1-sulfonamide;hydrochloride?
N-(1-amino-2,4-dimethylpentan-2-yl)-2-methylpentane-1-sulfonamide;hydrochloride has a molecular weight of 314.92 g/mol, XLogP of 2.53, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-amino-2,4-dimethylpentan-2-yl)-2-methylpentane-1-sulfonamide;hydrochloride is sourced from PubChem (CID 119985236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).