C12H26N2O4S — CID 115310020
ethyl 3-[(1-amino-2,4-dimethylpentan-2-yl)sulfamoyl]propanoate (PubChem CID 115310020) has the molecular formula C12H26N2O4S and a molecular weight of 294.42 g/mol. Its IUPAC name is ethyl 3-[(1-amino-2,4-dimethylpentan-2-yl)sulfamoyl]propanoate.
| Compound Name | ethyl 3-[(1-amino-2,4-dimethylpentan-2-yl)sulfamoyl]propanoate |
|---|---|
| PubChem CID | 115310020 |
| Molecular Formula | C12H26N2O4S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | ethyl 3-[(1-amino-2,4-dimethylpentan-2-yl)sulfamoyl]propanoate |
| SMILES | CCOC(=O)CCS(=O)(=O)NC(C)(CN)CC(C)C |
| InChI | InChI=1S/C12H26N2O4S/c1-5-18-11(15)6-7-19(16,17)14-12(4,9-13)8-10(2)3/h10,14H,5-9,13H2,1-4H3 |
| InChIKey | YVAMLNOCCGIPSG-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |