C7H19N3O2S — CID 114959433
1-amino-2,4-dimethyl-2-(sulfamoylamino)pentane (PubChem CID 114959433) has the molecular formula C7H19N3O2S and a molecular weight of 209.31 g/mol. Its IUPAC name is 1-amino-2,4-dimethyl-2-(sulfamoylamino)pentane.
| Compound Name | 1-amino-2,4-dimethyl-2-(sulfamoylamino)pentane |
|---|---|
| PubChem CID | 114959433 |
| Molecular Formula | C7H19N3O2S |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 1-amino-2,4-dimethyl-2-(sulfamoylamino)pentane |
| SMILES | CC(C)CC(C)(CN)NS(N)(=O)=O |
| InChI | InChI=1S/C7H19N3O2S/c1-6(2)4-7(3,5-8)10-13(9,11)12/h6,10H,4-5,8H2,1-3H3,(H2,9,11,12) |
| InChIKey | DVHPHXGRKXACIA-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |