C8H21N3O2S — CID 114811263
2,4-dimethyl-2-N-(methylsulfamoyl)pentane-1,2-diamine (PubChem CID 114811263) has the molecular formula C8H21N3O2S and a molecular weight of 223.34 g/mol. Its IUPAC name is 2,4-dimethyl-2-N-(methylsulfamoyl)pentane-1,2-diamine.
| Compound Name | 2,4-dimethyl-2-N-(methylsulfamoyl)pentane-1,2-diamine |
|---|---|
| PubChem CID | 114811263 |
| Molecular Formula | C8H21N3O2S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 2,4-dimethyl-2-N-(methylsulfamoyl)pentane-1,2-diamine |
| SMILES | CNS(=O)(=O)NC(C)(CN)CC(C)C |
| InChI | InChI=1S/C8H21N3O2S/c1-7(2)5-8(3,6-9)11-14(12,13)10-4/h7,10-11H,5-6,9H2,1-4H3 |
| InChIKey | WXURURFPXBAHMH-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |