C11H24N2O4S — CID 63888007
ethyl 3-[3-(aminomethyl)pentan-3-ylsulfamoyl]propanoate (PubChem CID 63888007) has the molecular formula C11H24N2O4S and a molecular weight of 280.39 g/mol. Its IUPAC name is ethyl 3-[3-(aminomethyl)pentan-3-ylsulfamoyl]propanoate.
| Compound Name | ethyl 3-[3-(aminomethyl)pentan-3-ylsulfamoyl]propanoate |
|---|---|
| PubChem CID | 63888007 |
| Molecular Formula | C11H24N2O4S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | ethyl 3-[3-(aminomethyl)pentan-3-ylsulfamoyl]propanoate |
| SMILES | CCOC(=O)CCS(=O)(=O)NC(CC)(CC)CN |
| InChI | InChI=1S/C11H24N2O4S/c1-4-11(5-2,9-12)13-18(15,16)8-7-10(14)17-6-3/h13H,4-9,12H2,1-3H3 |
| InChIKey | BGHFOWWWCRMVSJ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |