C9H18N2O4S2 — CID 54951322
ethyl 3-[(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)sulfamoyl]propanoate (PubChem CID 54951322) has the molecular formula C9H18N2O4S2 and a molecular weight of 282.39 g/mol. Its IUPAC name is ethyl 3-[(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)sulfamoyl]propanoate.
| Compound Name | ethyl 3-[(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)sulfamoyl]propanoate |
|---|---|
| PubChem CID | 54951322 |
| Molecular Formula | C9H18N2O4S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | ethyl 3-[(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)sulfamoyl]propanoate |
| SMILES | CCOC(=O)CCS(=O)(=O)NC(C)(C)C(N)=S |
| InChI | InChI=1S/C9H18N2O4S2/c1-4-15-7(12)5-6-17(13,14)11-9(2,3)8(10)16/h11H,4-6H2,1-3H3,(H2,10,16) |
| InChIKey | JVMSUKZJXKICNW-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|