C11H24N2O4S — CID 115310691
ethyl 3-[(1-amino-2,3-dimethylbutan-2-yl)sulfamoyl]propanoate (PubChem CID 115310691) has the molecular formula C11H24N2O4S and a molecular weight of 280.39 g/mol. Its IUPAC name is ethyl 3-[(1-amino-2,3-dimethylbutan-2-yl)sulfamoyl]propanoate.
| Compound Name | ethyl 3-[(1-amino-2,3-dimethylbutan-2-yl)sulfamoyl]propanoate |
|---|---|
| PubChem CID | 115310691 |
| Molecular Formula | C11H24N2O4S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | ethyl 3-[(1-amino-2,3-dimethylbutan-2-yl)sulfamoyl]propanoate |
| SMILES | CCOC(=O)CCS(=O)(=O)NC(C)(CN)C(C)C |
| InChI | InChI=1S/C11H24N2O4S/c1-5-17-10(14)6-7-18(15,16)13-11(4,8-12)9(2)3/h9,13H,5-8,12H2,1-4H3 |
| InChIKey | PHZDPVACGYEUGE-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |